C11H7NO4 — CID 11252923
6,8-dihydroxypyrrolo[2,1-b][1,3]benzoxazin-9-one (PubChem CID 11252923) has the molecular formula C11H7NO4 and a molecular weight of 217.18 g/mol. Its IUPAC name is 6,8-dihydroxypyrrolo[2,1-b][1,3]benzoxazin-9-one.
| Compound Name | 6,8-dihydroxypyrrolo[2,1-b][1,3]benzoxazin-9-one |
|---|---|
| PubChem CID | 11252923 |
| Molecular Formula | C11H7NO4 |
| Molecular Weight | 217.18 g/mol |
| Exact Mass | 217.04 |
| IUPAC Name | 6,8-dihydroxypyrrolo[2,1-b][1,3]benzoxazin-9-one |
| SMILES | O=c1c2c(O)cc(O)cc2oc2cccn12 |
| InChI | InChI=1S/C11H7NO4/c13-6-4-7(14)10-8(5-6)16-9-2-1-3-12(9)11(10)15/h1-5,13-14H |
| InChIKey | SEQZFUWODUNSSQ-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 75.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.18 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |