C16H8O5 — CID 10265646
1,3-dihydroxynaphtho[3,2-b][1]benzofuran-6,11-dione (PubChem CID 10265646) has the molecular formula C16H8O5 and a molecular weight of 280.23 g/mol. Its IUPAC name is 1,3-dihydroxynaphtho[3,2-b][1]benzofuran-6,11-dione.
| Compound Name | 1,3-dihydroxynaphtho[3,2-b][1]benzofuran-6,11-dione |
|---|---|
| PubChem CID | 10265646 |
| Molecular Formula | C16H8O5 |
| Molecular Weight | 280.23 g/mol |
| Exact Mass | 280.04 |
| IUPAC Name | 1,3-dihydroxynaphtho[3,2-b][1]benzofuran-6,11-dione |
| SMILES | O=C1c2ccccc2C(=O)c2c1oc1cc(O)cc(O)c21 |
| InChI | InChI=1S/C16H8O5/c17-7-5-10(18)12-11(6-7)21-16-13(12)14(19)8-3-1-2-4-9(8)15(16)20/h1-6,17-18H |
| InChIKey | BWOJLRXNVPTOIF-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.23 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|