C13H8O5S — CID 141458514
1,3,8-trihydroxy-5-sulfanylxanthen-9-one (PubChem CID 141458514) has the molecular formula C13H8O5S and a molecular weight of 276.27 g/mol. Its IUPAC name is 1,3,8-trihydroxy-5-sulfanylxanthen-9-one.
| Compound Name | 1,3,8-trihydroxy-5-sulfanylxanthen-9-one |
|---|---|
| PubChem CID | 141458514 |
| Molecular Formula | C13H8O5S |
| Molecular Weight | 276.27 g/mol |
| Exact Mass | 276.01 |
| IUPAC Name | 1,3,8-trihydroxy-5-sulfanylxanthen-9-one |
| SMILES | O=c1c2c(O)cc(O)cc2oc2c(S)ccc(O)c12 |
| InChI | InChI=1S/C13H8O5S/c14-5-3-7(16)10-8(4-5)18-13-9(19)2-1-6(15)11(13)12(10)17/h1-4,14-16,19H |
| InChIKey | ZZYWZOMOPFYDFP-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.27 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|