About 6,8-dihydroxy-2,3-dihydro-1H-cyclopenta[b]chromen-9-one
6,8-dihydroxy-2,3-dihydro-1H-cyclopenta[b]chromen-9-one (PubChem CID 175943536) has the molecular formula C12H10O4
and a molecular weight of 218.21 g/mol. Its IUPAC name is 6,8-dihydroxy-2,3-dihydro-1H-cyclopenta[b]chromen-9-one.
Molecular Properties
| Compound Name | 6,8-dihydroxy-2,3-dihydro-1H-cyclopenta[b]chromen-9-one |
| PubChem CID | 175943536 |
| Molecular Formula | C12H10O4 |
| Molecular Weight | 218.21 g/mol |
| Exact Mass | 218.06 |
| IUPAC Name | 6,8-dihydroxy-2,3-dihydro-1H-cyclopenta[b]chromen-9-one |
| SMILES | O=c1c2c(oc3cc(O)cc(O)c13)CCC2 |
| InChI | InChI=1S/C12H10O4/c13-6-4-8(14)11-10(5-6)16-9-3-1-2-7(9)12(11)15/h4-5,13-14H,1-3H2 |
| InChIKey | JTPTYSQHSHDGQY-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.21 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6,8-dihydroxy-2,3-dihydro-1H-cyclopenta[b]chromen-9-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,8-dihydroxy-2,3-dihydro-1H-cyclopenta[b]chromen-9-one?
The IUPAC name of 6,8-dihydroxy-2,3-dihydro-1H-cyclopenta[b]chromen-9-one (CID 175943536) is 6,8-dihydroxy-2,3-dihydro-1H-cyclopenta[b]chromen-9-one.
What is the SMILES notation for 6,8-dihydroxy-2,3-dihydro-1H-cyclopenta[b]chromen-9-one?
The canonical SMILES for 6,8-dihydroxy-2,3-dihydro-1H-cyclopenta[b]chromen-9-one is O=c1c2c(oc3cc(O)cc(O)c13)CCC2.
What is the InChIKey of 6,8-dihydroxy-2,3-dihydro-1H-cyclopenta[b]chromen-9-one?
The InChIKey is JTPTYSQHSHDGQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10O4/c13-6-4-8(14)11-10(5-6)16-9-3-1-2-7(9)12(11)15/h4-5,13-14H,1-3H2.
What are the key properties of 6,8-dihydroxy-2,3-dihydro-1H-cyclopenta[b]chromen-9-one?
6,8-dihydroxy-2,3-dihydro-1H-cyclopenta[b]chromen-9-one has a molecular weight of 218.21 g/mol, XLogP of 1.69, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6,8-dihydroxy-2,3-dihydro-1H-cyclopenta[b]chromen-9-one is sourced from PubChem (CID 175943536), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).