C15H13NO5 — CID 137061580
3,5,7-trihydroxy-2-(3-iminocyclohexen-1-yl)chromen-4-one (PubChem CID 137061580) has the molecular formula C15H13NO5 and a molecular weight of 287.27 g/mol. Its IUPAC name is 3,5,7-trihydroxy-2-(3-iminocyclohexen-1-yl)chromen-4-one.
| Compound Name | 3,5,7-trihydroxy-2-(3-iminocyclohexen-1-yl)chromen-4-one |
|---|---|
| PubChem CID | 137061580 |
| Molecular Formula | C15H13NO5 |
| Molecular Weight | 287.27 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | 3,5,7-trihydroxy-2-(3-iminocyclohexen-1-yl)chromen-4-one |
| SMILES | [H]/N=C1/C=C(c2oc3cc(O)cc(O)c3c(=O)c2O)CCC1 |
| InChI | InChI=1S/C15H13NO5/c16-8-3-1-2-7(4-8)15-14(20)13(19)12-10(18)5-9(17)6-11(12)21-15/h4-6,16-18,20H,1-3H2/b16-8+ |
| InChIKey | CXGIGAGUBCJDMC-LZYBPNLTSA-N |
| XLogP | 2.50 |
| TPSA | 114.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.27 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|