C18H12O8 — CID 52918125
3,4,6,8-tetrahydroxy-1-(4-methyl-5-oxo-2H-furan-2-yl)xanthen-9-one (PubChem CID 52918125) has the molecular formula C18H12O8 and a molecular weight of 356.29 g/mol. Its IUPAC name is 3,4,6,8-tetrahydroxy-1-(4-methyl-5-oxo-2H-furan-2-yl)xanthen-9-one.
| Compound Name | 3,4,6,8-tetrahydroxy-1-(4-methyl-5-oxo-2H-furan-2-yl)xanthen-9-one |
|---|---|
| PubChem CID | 52918125 |
| Molecular Formula | C18H12O8 |
| Molecular Weight | 356.29 g/mol |
| Exact Mass | 356.05 |
| IUPAC Name | 3,4,6,8-tetrahydroxy-1-(4-methyl-5-oxo-2H-furan-2-yl)xanthen-9-one |
| SMILES | CC1=CC(c2cc(O)c(O)c3oc4cc(O)cc(O)c4c(=O)c23)OC1=O |
| InChI | InChI=1S/C18H12O8/c1-6-2-11(26-18(6)24)8-5-10(21)15(22)17-13(8)16(23)14-9(20)3-7(19)4-12(14)25-17/h2-5,11,19-22H,1H3 |
| InChIKey | FNWVTNYGGFPWNK-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 137.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.29 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|