C25H22O11 — CID 162921886
(2R,3S)-8,10-dihydroxy-3-(4-hydroxy-3,5-dimethoxyphenyl)-2-(hydroxymethyl)-5-methoxy-2,3-dihydro-[1,4]dioxino[2,3-c]xanthen-7-one (PubChem CID 162921886) has the molecular formula C25H22O11 and a molecular weight of 498.44 g/mol. Its IUPAC name is (2R,3S)-8,10-dihydroxy-3-(4-hydroxy-3,5-dimethoxyphenyl)-2-(hydroxymethyl)-5-methoxy-2,3-dihydro-[1,4]dioxino[2,3-c]xanthen-7-one.
| Compound Name | (2R,3S)-8,10-dihydroxy-3-(4-hydroxy-3,5-dimethoxyphenyl)-2-(hydroxymethyl)-5-methoxy-2,3-dihydro-[1,4]dioxino[2,3-c]xanthen-7-one |
|---|---|
| PubChem CID | 162921886 |
| Molecular Formula | C25H22O11 |
| Molecular Weight | 498.44 g/mol |
| Exact Mass | 498.12 |
| IUPAC Name | (2R,3S)-8,10-dihydroxy-3-(4-hydroxy-3,5-dimethoxyphenyl)-2-(hydroxymethyl)-5-methoxy-2,3-dihydro-[1,4]dioxino[2,3-c]xanthen-7-one |
| SMILES | COc1cc([C@@H]2Oc3c(OC)cc4c(=O)c5c(O)cc(O)cc5oc4c3O[C@@H]2CO)cc(OC)c1O |
| InChI | InChI=1S/C25H22O11/c1-31-15-4-10(5-16(32-2)21(15)30)22-18(9-26)35-25-23-12(8-17(33-3)24(25)36-22)20(29)19-13(28)6-11(27)7-14(19)34-23/h4-8,18,22,26-28,30H,9H2,1-3H3/t18-,22+/m1/s1 |
| InChIKey | LPJRGKHCMHTXJG-GCJKJVERSA-N |
| XLogP | 2.96 |
| TPSA | 157.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.44 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|