C25H22O9 — CID 163047097
(2S,3R)-3-(4-hydroxy-3-methoxyphenyl)-2-(hydroxymethyl)-5,8-dimethoxy-2,3-dihydro-[1,4]dioxino[2,3-c]xanthen-7-one (PubChem CID 163047097) has the molecular formula C25H22O9 and a molecular weight of 466.44 g/mol. Its IUPAC name is (2S,3R)-3-(4-hydroxy-3-methoxyphenyl)-2-(hydroxymethyl)-5,8-dimethoxy-2,3-dihydro-[1,4]dioxino[2,3-c]xanthen-7-one.
| Compound Name | (2S,3R)-3-(4-hydroxy-3-methoxyphenyl)-2-(hydroxymethyl)-5,8-dimethoxy-2,3-dihydro-[1,4]dioxino[2,3-c]xanthen-7-one |
|---|---|
| PubChem CID | 163047097 |
| Molecular Formula | C25H22O9 |
| Molecular Weight | 466.44 g/mol |
| Exact Mass | 466.13 |
| IUPAC Name | (2S,3R)-3-(4-hydroxy-3-methoxyphenyl)-2-(hydroxymethyl)-5,8-dimethoxy-2,3-dihydro-[1,4]dioxino[2,3-c]xanthen-7-one |
| SMILES | COc1cc([C@H]2Oc3c(OC)cc4c(=O)c5c(OC)cccc5oc4c3O[C@H]2CO)ccc1O |
| InChI | InChI=1S/C25H22O9/c1-29-15-5-4-6-16-20(15)21(28)13-10-18(31-3)24-25(23(13)32-16)33-19(11-26)22(34-24)12-7-8-14(27)17(9-12)30-2/h4-10,19,22,26-27H,11H2,1-3H3/t19-,22+/m0/s1 |
| InChIKey | WOYNOOIIEKNLEF-SIKLNZKXSA-N |
| XLogP | 3.55 |
| TPSA | 116.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.44 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|