C37H28O10 — CID 70183638
(2S,3S)-3-(4-hydroxy-3-methoxyphenyl)-2-(hydroxymethyl)-5-methoxy-2,3-dihydro-[1,4]dioxino[2,3-c]xanthen-7-one;xanthen-9-one (PubChem CID 70183638) has the molecular formula C37H28O10 and a molecular weight of 632.62 g/mol. Its IUPAC name is (2S,3S)-3-(4-hydroxy-3-methoxyphenyl)-2-(hydroxymethyl)-5-methoxy-2,3-dihydro-[1,4]dioxino[2,3-c]xanthen-7-one;xanthen-9-one.
| Compound Name | (2S,3S)-3-(4-hydroxy-3-methoxyphenyl)-2-(hydroxymethyl)-5-methoxy-2,3-dihydro-[1,4]dioxino[2,3-c]xanthen-7-one;xanthen-9-one |
|---|---|
| PubChem CID | 70183638 |
| Molecular Formula | C37H28O10 |
| Molecular Weight | 632.62 g/mol |
| Exact Mass | 632.17 |
| IUPAC Name | (2S,3S)-3-(4-hydroxy-3-methoxyphenyl)-2-(hydroxymethyl)-5-methoxy-2,3-dihydro-[1,4]dioxino[2,3-c]xanthen-7-one;xanthen-9-one |
| SMILES | COc1cc([C@@H]2Oc3c(OC)cc4c(=O)c5ccccc5oc4c3O[C@H]2CO)ccc1O.O=c1c2ccccc2oc2ccccc12 |
| InChI | InChI=1S/C24H20O8.C13H8O2/c1-28-17-9-12(7-8-15(17)26)21-19(11-25)31-24-22-14(10-18(29-2)23(24)32-21)20(27)13-5-3-4-6-16(13)30-22;14-13-9-5-1-3-7-11(9)15-12-8-4-2-6-10(12)13/h3-10,19,21,25-26H,11H2,1-2H3;1-8H/t19-,21-;/m0./s1 |
| InChIKey | ZKCZWXXZINZNRS-RQBPZYBGSA-N |
| XLogP | 6.49 |
| TPSA | 137.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.62 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|