C26H22O10 — CID 162956328
2,3,8,10-tetrahydroxy-6-(4-hydroxy-3,5-dimethoxyphenyl)-5-(hydroxymethyl)-5,6-dihydrobenzo[c]xanthen-7-one (PubChem CID 162956328) has the molecular formula C26H22O10 and a molecular weight of 494.45 g/mol. Its IUPAC name is 2,3,8,10-tetrahydroxy-6-(4-hydroxy-3,5-dimethoxyphenyl)-5-(hydroxymethyl)-5,6-dihydrobenzo[c]xanthen-7-one.
| Compound Name | 2,3,8,10-tetrahydroxy-6-(4-hydroxy-3,5-dimethoxyphenyl)-5-(hydroxymethyl)-5,6-dihydrobenzo[c]xanthen-7-one |
|---|---|
| PubChem CID | 162956328 |
| Molecular Formula | C26H22O10 |
| Molecular Weight | 494.45 g/mol |
| Exact Mass | 494.12 |
| IUPAC Name | 2,3,8,10-tetrahydroxy-6-(4-hydroxy-3,5-dimethoxyphenyl)-5-(hydroxymethyl)-5,6-dihydrobenzo[c]xanthen-7-one |
| SMILES | COc1cc(C2c3c(oc4cc(O)cc(O)c4c3=O)-c3cc(O)c(O)cc3C2CO)cc(OC)c1O |
| InChI | InChI=1S/C26H22O10/c1-34-19-3-10(4-20(35-2)24(19)32)21-14(9-27)12-7-15(29)16(30)8-13(12)26-23(21)25(33)22-17(31)5-11(28)6-18(22)36-26/h3-8,14,21,27-32H,9H2,1-2H3 |
| InChIKey | XTFMDNRRLBTZHO-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 170.05 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.45 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|