C25H20O9 — CID 162907468
(5R,6S)-2,3,8,10-tetrahydroxy-6-(4-hydroxy-3-methoxyphenyl)-5-(hydroxymethyl)-5,6-dihydrobenzo[c]xanthen-7-one (PubChem CID 162907468) has the molecular formula C25H20O9 and a molecular weight of 464.43 g/mol. Its IUPAC name is (5R,6S)-2,3,8,10-tetrahydroxy-6-(4-hydroxy-3-methoxyphenyl)-5-(hydroxymethyl)-5,6-dihydrobenzo[c]xanthen-7-one.
| Compound Name | (5R,6S)-2,3,8,10-tetrahydroxy-6-(4-hydroxy-3-methoxyphenyl)-5-(hydroxymethyl)-5,6-dihydrobenzo[c]xanthen-7-one |
|---|---|
| PubChem CID | 162907468 |
| Molecular Formula | C25H20O9 |
| Molecular Weight | 464.43 g/mol |
| Exact Mass | 464.11 |
| IUPAC Name | (5R,6S)-2,3,8,10-tetrahydroxy-6-(4-hydroxy-3-methoxyphenyl)-5-(hydroxymethyl)-5,6-dihydrobenzo[c]xanthen-7-one |
| SMILES | COc1cc([C@H]2c3c(oc4cc(O)cc(O)c4c3=O)-c3cc(O)c(O)cc3[C@@H]2CO)ccc1O |
| InChI | InChI=1S/C25H20O9/c1-33-19-4-10(2-3-15(19)28)21-14(9-26)12-7-16(29)17(30)8-13(12)25-23(21)24(32)22-18(31)5-11(27)6-20(22)34-25/h2-8,14,21,26-31H,9H2,1H3/t14-,21+/m0/s1 |
| InChIKey | KQRVYPVRZSAZBB-LHSJRXKWSA-N |
| XLogP | 3.22 |
| TPSA | 160.82 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.43 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|