C37H32O13 — CID 162864610
3,4,6,8-tetrahydroxy-1-[6-[methoxy-(3,4,6,8-tetrahydroxy-9-oxoxanthen-1-yl)methyl]-3,5,5-trimethylcyclohex-2-en-1-yl]xanthen-9-one (PubChem CID 162864610) has the molecular formula C37H32O13 and a molecular weight of 684.65 g/mol. Its IUPAC name is 3,4,6,8-tetrahydroxy-1-[6-[methoxy-(3,4,6,8-tetrahydroxy-9-oxoxanthen-1-yl)methyl]-3,5,5-trimethylcyclohex-2-en-1-yl]xanthen-9-one.
| Compound Name | 3,4,6,8-tetrahydroxy-1-[6-[methoxy-(3,4,6,8-tetrahydroxy-9-oxoxanthen-1-yl)methyl]-3,5,5-trimethylcyclohex-2-en-1-yl]xanthen-9-one |
|---|---|
| PubChem CID | 162864610 |
| Molecular Formula | C37H32O13 |
| Molecular Weight | 684.65 g/mol |
| Exact Mass | 684.18 |
| IUPAC Name | 3,4,6,8-tetrahydroxy-1-[6-[methoxy-(3,4,6,8-tetrahydroxy-9-oxoxanthen-1-yl)methyl]-3,5,5-trimethylcyclohex-2-en-1-yl]xanthen-9-one |
| SMILES | COC(c1cc(O)c(O)c2oc3cc(O)cc(O)c3c(=O)c12)C1C(c2cc(O)c(O)c3oc4cc(O)cc(O)c4c(=O)c23)C=C(C)CC1(C)C |
| InChI | InChI=1S/C37H32O13/c1-13-5-17(16-10-21(42)30(44)35-25(16)32(46)27-19(40)6-14(38)8-23(27)49-35)29(37(2,3)12-13)34(48-4)18-11-22(43)31(45)36-26(18)33(47)28-20(41)7-15(39)9-24(28)50-36/h5-11,17,29,34,38-45H,12H2,1-4H3 |
| InChIKey | NBAWIKFNFWOFRT-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 231.49 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 50 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.65 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|