C12H9F3O4 — CID 24806887
5,7-dihydroxy-4-(3,3,3-trifluoropropyl)chromen-2-one (PubChem CID 24806887) has the molecular formula C12H9F3O4 and a molecular weight of 274.19 g/mol. Its IUPAC name is 5,7-dihydroxy-4-(3,3,3-trifluoropropyl)chromen-2-one.
| Compound Name | 5,7-dihydroxy-4-(3,3,3-trifluoropropyl)chromen-2-one |
|---|---|
| PubChem CID | 24806887 |
| Molecular Formula | C12H9F3O4 |
| Molecular Weight | 274.19 g/mol |
| Exact Mass | 274.05 |
| IUPAC Name | 5,7-dihydroxy-4-(3,3,3-trifluoropropyl)chromen-2-one |
| SMILES | O=c1cc(CCC(F)(F)F)c2c(O)cc(O)cc2o1 |
| InChI | InChI=1S/C12H9F3O4/c13-12(14,15)2-1-6-3-10(18)19-9-5-7(16)4-8(17)11(6)9/h3-5,16-17H,1-2H2 |
| InChIKey | LLGKQUXXEZUBHB-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.19 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|