C22H19Cl2NO4 — CID 99802605
6-chloro-4-[[4-(4-chlorobenzoyl)piperidin-1-yl]methyl]-7-hydroxychromen-2-one (PubChem CID 99802605) has the molecular formula C22H19Cl2NO4 and a molecular weight of 432.30 g/mol. Its IUPAC name is 6-chloro-4-[[4-(4-chlorobenzoyl)piperidin-1-yl]methyl]-7-hydroxychromen-2-one.
| Compound Name | 6-chloro-4-[[4-(4-chlorobenzoyl)piperidin-1-yl]methyl]-7-hydroxychromen-2-one |
|---|---|
| PubChem CID | 99802605 |
| Molecular Formula | C22H19Cl2NO4 |
| Molecular Weight | 432.30 g/mol |
| Exact Mass | 431.07 |
| IUPAC Name | 6-chloro-4-[[4-(4-chlorobenzoyl)piperidin-1-yl]methyl]-7-hydroxychromen-2-one |
| SMILES | O=C(c1ccc(Cl)cc1)C1CCN(Cc2cc(=O)oc3cc(O)c(Cl)cc23)CC1 |
| InChI | InChI=1S/C22H19Cl2NO4/c23-16-3-1-13(2-4-16)22(28)14-5-7-25(8-6-14)12-15-9-21(27)29-20-11-19(26)18(24)10-17(15)20/h1-4,9-11,14,26H,5-8,12H2 |
| InChIKey | KQVAXZFTIJXUSX-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 70.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.30 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|