C9H10F3NO6S — CID 175511239
2-amino-3-(2,5-difluoro-4-hydroxyphenyl)propanoic acid;sulfurofluoridic acid (PubChem CID 175511239) has the molecular formula C9H10F3NO6S and a molecular weight of 317.24 g/mol. Its IUPAC name is 2-amino-3-(2,5-difluoro-4-hydroxyphenyl)propanoic acid;sulfurofluoridic acid.
| Compound Name | 2-amino-3-(2,5-difluoro-4-hydroxyphenyl)propanoic acid;sulfurofluoridic acid |
|---|---|
| PubChem CID | 175511239 |
| Molecular Formula | C9H10F3NO6S |
| Molecular Weight | 317.24 g/mol |
| Exact Mass | 317.02 |
| IUPAC Name | 2-amino-3-(2,5-difluoro-4-hydroxyphenyl)propanoic acid;sulfurofluoridic acid |
| SMILES | NC(Cc1cc(F)c(O)cc1F)C(=O)O.O=S(=O)(O)F |
| InChI | InChI=1S/C9H9F2NO3.FHO3S/c10-5-3-8(13)6(11)1-4(5)2-7(12)9(14)15;1-5(2,3)4/h1,3,7,13H,2,12H2,(H,14,15);(H,2,3,4) |
| InChIKey | LQAYFLDYEHWXKT-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 137.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.24 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|