C14H14BrNO4S — CID 60929413
2-amino-4-[(7-bromo-2-oxochromen-4-yl)methylsulfanyl]butanoic acid (PubChem CID 60929413) has the molecular formula C14H14BrNO4S and a molecular weight of 372.24 g/mol. Its IUPAC name is 2-amino-4-[(7-bromo-2-oxochromen-4-yl)methylsulfanyl]butanoic acid.
| Compound Name | 2-amino-4-[(7-bromo-2-oxochromen-4-yl)methylsulfanyl]butanoic acid |
|---|---|
| PubChem CID | 60929413 |
| Molecular Formula | C14H14BrNO4S |
| Molecular Weight | 372.24 g/mol |
| Exact Mass | 370.98 |
| IUPAC Name | 2-amino-4-[(7-bromo-2-oxochromen-4-yl)methylsulfanyl]butanoic acid |
| SMILES | NC(CCSCc1cc(=O)oc2cc(Br)ccc12)C(=O)O |
| InChI | InChI=1S/C14H14BrNO4S/c15-9-1-2-10-8(5-13(17)20-12(10)6-9)7-21-4-3-11(16)14(18)19/h1-2,5-6,11H,3-4,7,16H2,(H,18,19) |
| InChIKey | CARJHAXCICGILF-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.24 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|