C14H14BrNO4 — CID 62638707
2-[(7-bromo-2-oxochromen-4-yl)methyl-methylamino]propanoic acid (PubChem CID 62638707) has the molecular formula C14H14BrNO4 and a molecular weight of 340.17 g/mol. Its IUPAC name is 2-[(7-bromo-2-oxochromen-4-yl)methyl-methylamino]propanoic acid.
| Compound Name | 2-[(7-bromo-2-oxochromen-4-yl)methyl-methylamino]propanoic acid |
|---|---|
| PubChem CID | 62638707 |
| Molecular Formula | C14H14BrNO4 |
| Molecular Weight | 340.17 g/mol |
| Exact Mass | 339.01 |
| IUPAC Name | 2-[(7-bromo-2-oxochromen-4-yl)methyl-methylamino]propanoic acid |
| SMILES | CC(C(=O)O)N(C)Cc1cc(=O)oc2cc(Br)ccc12 |
| InChI | InChI=1S/C14H14BrNO4/c1-8(14(18)19)16(2)7-9-5-13(17)20-12-6-10(15)3-4-11(9)12/h3-6,8H,7H2,1-2H3,(H,18,19) |
| InChIKey | YLABSYFIWRLDLD-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 70.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.17 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|