C15H16BrNO4 — CID 79790711
2-[(7-bromo-2-oxochromen-4-yl)methylamino]-2-methylbutanoic acid (PubChem CID 79790711) has the molecular formula C15H16BrNO4 and a molecular weight of 354.20 g/mol. Its IUPAC name is 2-[(7-bromo-2-oxochromen-4-yl)methylamino]-2-methylbutanoic acid.
| Compound Name | 2-[(7-bromo-2-oxochromen-4-yl)methylamino]-2-methylbutanoic acid |
|---|---|
| PubChem CID | 79790711 |
| Molecular Formula | C15H16BrNO4 |
| Molecular Weight | 354.20 g/mol |
| Exact Mass | 353.03 |
| IUPAC Name | 2-[(7-bromo-2-oxochromen-4-yl)methylamino]-2-methylbutanoic acid |
| SMILES | CCC(C)(NCc1cc(=O)oc2cc(Br)ccc12)C(=O)O |
| InChI | InChI=1S/C15H16BrNO4/c1-3-15(2,14(19)20)17-8-9-6-13(18)21-12-7-10(16)4-5-11(9)12/h4-7,17H,3,8H2,1-2H3,(H,19,20) |
| InChIKey | FXOHUWKDIRUJQQ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.20 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|