C16H21BrN2O2 — CID 79646049
4-[[(3-amino-2,2-dimethylpropyl)-methylamino]methyl]-7-bromochromen-2-one (PubChem CID 79646049) has the molecular formula C16H21BrN2O2 and a molecular weight of 353.26 g/mol. Its IUPAC name is 4-[[(3-amino-2,2-dimethylpropyl)-methylamino]methyl]-7-bromochromen-2-one.
| Compound Name | 4-[[(3-amino-2,2-dimethylpropyl)-methylamino]methyl]-7-bromochromen-2-one |
|---|---|
| PubChem CID | 79646049 |
| Molecular Formula | C16H21BrN2O2 |
| Molecular Weight | 353.26 g/mol |
| Exact Mass | 352.08 |
| IUPAC Name | 4-[[(3-amino-2,2-dimethylpropyl)-methylamino]methyl]-7-bromochromen-2-one |
| SMILES | CN(Cc1cc(=O)oc2cc(Br)ccc12)CC(C)(C)CN |
| InChI | InChI=1S/C16H21BrN2O2/c1-16(2,9-18)10-19(3)8-11-6-15(20)21-14-7-12(17)4-5-13(11)14/h4-7H,8-10,18H2,1-3H3 |
| InChIKey | LIPLFRAMPZABGE-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 59.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.26 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|