C15H18BrNO3 — CID 60692198
7-bromo-4-[[2-hydroxyethyl(propyl)amino]methyl]chromen-2-one (PubChem CID 60692198) has the molecular formula C15H18BrNO3 and a molecular weight of 340.22 g/mol. Its IUPAC name is 7-bromo-4-[[2-hydroxyethyl(propyl)amino]methyl]chromen-2-one.
| Compound Name | 7-bromo-4-[[2-hydroxyethyl(propyl)amino]methyl]chromen-2-one |
|---|---|
| PubChem CID | 60692198 |
| Molecular Formula | C15H18BrNO3 |
| Molecular Weight | 340.22 g/mol |
| Exact Mass | 339.05 |
| IUPAC Name | 7-bromo-4-[[2-hydroxyethyl(propyl)amino]methyl]chromen-2-one |
| SMILES | CCCN(CCO)Cc1cc(=O)oc2cc(Br)ccc12 |
| InChI | InChI=1S/C15H18BrNO3/c1-2-5-17(6-7-18)10-11-8-15(19)20-14-9-12(16)3-4-13(11)14/h3-4,8-9,18H,2,5-7,10H2,1H3 |
| InChIKey | CREXDGIBAJLYCO-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 53.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.22 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|