C17H23NO4 — CID 111436393
4-[[2-hydroxyethyl(2-methoxyethyl)amino]methyl]-6,7-dimethylchromen-2-one (PubChem CID 111436393) has the molecular formula C17H23NO4 and a molecular weight of 305.37 g/mol. Its IUPAC name is 4-[[2-hydroxyethyl(2-methoxyethyl)amino]methyl]-6,7-dimethylchromen-2-one.
| Compound Name | 4-[[2-hydroxyethyl(2-methoxyethyl)amino]methyl]-6,7-dimethylchromen-2-one |
|---|---|
| PubChem CID | 111436393 |
| Molecular Formula | C17H23NO4 |
| Molecular Weight | 305.37 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | 4-[[2-hydroxyethyl(2-methoxyethyl)amino]methyl]-6,7-dimethylchromen-2-one |
| SMILES | COCCN(CCO)Cc1cc(=O)oc2cc(C)c(C)cc12 |
| InChI | InChI=1S/C17H23NO4/c1-12-8-15-14(11-18(4-6-19)5-7-21-3)10-17(20)22-16(15)9-13(12)2/h8-10,19H,4-7,11H2,1-3H3 |
| InChIKey | SDFCEQLZDRBURX-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 62.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.37 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|