C24H28N2O4 — CID 9168558
2-[(6,7-dimethyl-2-oxochromen-4-yl)methyl-propylamino]-N-(2-methoxyphenyl)acetamide (PubChem CID 9168558) has the molecular formula C24H28N2O4 and a molecular weight of 408.50 g/mol. Its IUPAC name is 2-[(6,7-dimethyl-2-oxochromen-4-yl)methyl-propylamino]-N-(2-methoxyphenyl)acetamide.
| Compound Name | 2-[(6,7-dimethyl-2-oxochromen-4-yl)methyl-propylamino]-N-(2-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 9168558 |
| Molecular Formula | C24H28N2O4 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | 2-[(6,7-dimethyl-2-oxochromen-4-yl)methyl-propylamino]-N-(2-methoxyphenyl)acetamide |
| SMILES | CCCN(CC(=O)Nc1ccccc1OC)Cc1cc(=O)oc2cc(C)c(C)cc12 |
| InChI | InChI=1S/C24H28N2O4/c1-5-10-26(15-23(27)25-20-8-6-7-9-21(20)29-4)14-18-13-24(28)30-22-12-17(3)16(2)11-19(18)22/h6-9,11-13H,5,10,14-15H2,1-4H3,(H,25,27) |
| InChIKey | SBNRJNILVFGTMM-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|