C21H23ClN4O3 — CID 9168823
2-[[2-(5-chloro-2-cyanoanilino)-2-oxoethyl]-propylamino]-N-(2-methoxyphenyl)acetamide (PubChem CID 9168823) has the molecular formula C21H23ClN4O3 and a molecular weight of 414.89 g/mol. Its IUPAC name is 2-[[2-(5-chloro-2-cyanoanilino)-2-oxoethyl]-propylamino]-N-(2-methoxyphenyl)acetamide.
| Compound Name | 2-[[2-(5-chloro-2-cyanoanilino)-2-oxoethyl]-propylamino]-N-(2-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 9168823 |
| Molecular Formula | C21H23ClN4O3 |
| Molecular Weight | 414.89 g/mol |
| Exact Mass | 414.15 |
| IUPAC Name | 2-[[2-(5-chloro-2-cyanoanilino)-2-oxoethyl]-propylamino]-N-(2-methoxyphenyl)acetamide |
| SMILES | CCCN(CC(=O)Nc1cc(Cl)ccc1C#N)CC(=O)Nc1ccccc1OC |
| InChI | InChI=1S/C21H23ClN4O3/c1-3-10-26(13-20(27)24-17-6-4-5-7-19(17)29-2)14-21(28)25-18-11-16(22)9-8-15(18)12-23/h4-9,11H,3,10,13-14H2,1-2H3,(H,24,27)(H,25,28) |
| InChIKey | XRAFABWXFJZDQF-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 94.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.89 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |