C10H8O10S2 — CID 13963
View drug profile → sulmarin(4-methyl-2-oxo-6-sulfooxychromen-7-yl) hydrogen sulfate (PubChem CID 13963) has the molecular formula C10H8O10S2 and a molecular weight of 352.30 g/mol. Its IUPAC name is (4-methyl-2-oxo-6-sulfooxychromen-7-yl) hydrogen sulfate.
| Compound Name | (4-methyl-2-oxo-6-sulfooxychromen-7-yl) hydrogen sulfate |
|---|---|
| PubChem CID | 13963 |
| Molecular Formula | C10H8O10S2 |
| Molecular Weight | 352.30 g/mol |
| Exact Mass | 351.96 |
| IUPAC Name | (4-methyl-2-oxo-6-sulfooxychromen-7-yl) hydrogen sulfate |
| SMILES | Cc1cc(=O)oc2cc(OS(=O)(=O)O)c(OS(=O)(=O)O)cc12 |
| InChI | InChI=1S/C10H8O10S2/c1-5-2-10(11)18-7-4-9(20-22(15,16)17)8(3-6(5)7)19-21(12,13)14/h2-4H,1H3,(H,12,13,14)(H,15,16,17) |
| InChIKey | SZNQDPUZKFSCNG-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 157.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.30 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|