C17H13BrN2O3 — CID 139228701
4-bromo-16-methyl-11-propyl-8,14-dioxa-12,15-diazatetracyclo[8.7.0.02,7.013,17]heptadeca-1(17),2(7),3,5,10,12,15-heptaen-9-one (PubChem CID 139228701) has the molecular formula C17H13BrN2O3 and a molecular weight of 373.21 g/mol. Its IUPAC name is 4-bromo-16-methyl-11-propyl-8,14-dioxa-12,15-diazatetracyclo[8.7.0.02,7.013,17]heptadeca-1(17),2(7),3,5,10,12,15-heptaen-9-one.
| Compound Name | 4-bromo-16-methyl-11-propyl-8,14-dioxa-12,15-diazatetracyclo[8.7.0.02,7.013,17]heptadeca-1(17),2(7),3,5,10,12,15-heptaen-9-one |
|---|---|
| PubChem CID | 139228701 |
| Molecular Formula | C17H13BrN2O3 |
| Molecular Weight | 373.21 g/mol |
| Exact Mass | 372.01 |
| IUPAC Name | 4-bromo-16-methyl-11-propyl-8,14-dioxa-12,15-diazatetracyclo[8.7.0.02,7.013,17]heptadeca-1(17),2(7),3,5,10,12,15-heptaen-9-one |
| SMILES | CCCc1nc2onc(C)c2c2c1c(=O)oc1ccc(Br)cc12 |
| InChI | InChI=1S/C17H13BrN2O3/c1-3-4-11-15-14(13-8(2)20-23-16(13)19-11)10-7-9(18)5-6-12(10)22-17(15)21/h5-7H,3-4H2,1-2H3 |
| InChIKey | WSRKXCKWIUINFS-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 69.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.21 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|