C36H16F6O6 — CID 163600179
5-[4-[1,3-dioxo-4-(trifluoromethyl)-2-benzofuran-5-yl]-2,5-diphenylphenyl]-4-(trifluoromethyl)-2-benzofuran-1,3-dione (PubChem CID 163600179) has the molecular formula C36H16F6O6 and a molecular weight of 658.51 g/mol. Its IUPAC name is 5-[4-[1,3-dioxo-4-(trifluoromethyl)-2-benzofuran-5-yl]-2,5-diphenylphenyl]-4-(trifluoromethyl)-2-benzofuran-1,3-dione.
| Compound Name | 5-[4-[1,3-dioxo-4-(trifluoromethyl)-2-benzofuran-5-yl]-2,5-diphenylphenyl]-4-(trifluoromethyl)-2-benzofuran-1,3-dione |
|---|---|
| PubChem CID | 163600179 |
| Molecular Formula | C36H16F6O6 |
| Molecular Weight | 658.51 g/mol |
| Exact Mass | 658.09 |
| IUPAC Name | 5-[4-[1,3-dioxo-4-(trifluoromethyl)-2-benzofuran-5-yl]-2,5-diphenylphenyl]-4-(trifluoromethyl)-2-benzofuran-1,3-dione |
| SMILES | O=C1OC(=O)c2c1ccc(-c1cc(-c3ccccc3)c(-c3ccc4c(c3C(F)(F)F)C(=O)OC4=O)cc1-c1ccccc1)c2C(F)(F)F |
| InChI | InChI=1S/C36H16F6O6/c37-35(38,39)29-19(11-13-21-27(29)33(45)47-31(21)43)25-16-24(18-9-5-2-6-10-18)26(15-23(25)17-7-3-1-4-8-17)20-12-14-22-28(30(20)36(40,41)42)34(46)48-32(22)44/h1-16H |
| InChIKey | GWXIVCWZZUPWCG-UHFFFAOYSA-N |
| XLogP | 9.01 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.51 |
| LogP ≤ 5 | 9.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|