C18H6F6O8 — CID 154019436
3-[[1,3-dioxo-4-(trifluoromethyl)-2-benzofuran-5-yl]oxy]-6-(trifluoromethyl)phthalic acid (PubChem CID 154019436) has the molecular formula C18H6F6O8 and a molecular weight of 464.23 g/mol. Its IUPAC name is 3-[[1,3-dioxo-4-(trifluoromethyl)-2-benzofuran-5-yl]oxy]-6-(trifluoromethyl)phthalic acid.
| Compound Name | 3-[[1,3-dioxo-4-(trifluoromethyl)-2-benzofuran-5-yl]oxy]-6-(trifluoromethyl)phthalic acid |
|---|---|
| PubChem CID | 154019436 |
| Molecular Formula | C18H6F6O8 |
| Molecular Weight | 464.23 g/mol |
| Exact Mass | 464.00 |
| IUPAC Name | 3-[[1,3-dioxo-4-(trifluoromethyl)-2-benzofuran-5-yl]oxy]-6-(trifluoromethyl)phthalic acid |
| SMILES | O=C1OC(=O)c2c1ccc(Oc1ccc(C(F)(F)F)c(C(=O)O)c1C(=O)O)c2C(F)(F)F |
| InChI | InChI=1S/C18H6F6O8/c19-17(20,21)6-2-4-7(11(14(27)28)10(6)13(25)26)31-8-3-1-5-9(12(8)18(22,23)24)16(30)32-15(5)29/h1-4H,(H,25,26)(H,27,28) |
| InChIKey | CRCBTUJNEGKJQF-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.23 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|