C16H8F6O5 — CID 23354673
3-(trifluoromethyl)-4-[2-(trifluoromethyl)phenoxy]phthalic acid (PubChem CID 23354673) has the molecular formula C16H8F6O5 and a molecular weight of 394.22 g/mol. Its IUPAC name is 3-(trifluoromethyl)-4-[2-(trifluoromethyl)phenoxy]phthalic acid.
| Compound Name | 3-(trifluoromethyl)-4-[2-(trifluoromethyl)phenoxy]phthalic acid |
|---|---|
| PubChem CID | 23354673 |
| Molecular Formula | C16H8F6O5 |
| Molecular Weight | 394.22 g/mol |
| Exact Mass | 394.03 |
| IUPAC Name | 3-(trifluoromethyl)-4-[2-(trifluoromethyl)phenoxy]phthalic acid |
| SMILES | O=C(O)c1ccc(Oc2ccccc2C(F)(F)F)c(C(F)(F)F)c1C(=O)O |
| InChI | InChI=1S/C16H8F6O5/c17-15(18,19)8-3-1-2-4-9(8)27-10-6-5-7(13(23)24)11(14(25)26)12(10)16(20,21)22/h1-6H,(H,23,24)(H,25,26) |
| InChIKey | SRNQFERITZCVRC-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.22 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |