C13H8O6 — CID 118495757
1,4,5,6-tetrahydroxyxanthen-3-one (PubChem CID 118495757) has the molecular formula C13H8O6 and a molecular weight of 260.20 g/mol. Its IUPAC name is 1,4,5,6-tetrahydroxyxanthen-3-one.
| Compound Name | 1,4,5,6-tetrahydroxyxanthen-3-one |
|---|---|
| PubChem CID | 118495757 |
| Molecular Formula | C13H8O6 |
| Molecular Weight | 260.20 g/mol |
| Exact Mass | 260.03 |
| IUPAC Name | 1,4,5,6-tetrahydroxyxanthen-3-one |
| SMILES | O=c1cc(O)c2cc3ccc(O)c(O)c3oc-2c1O |
| InChI | InChI=1S/C13H8O6/c14-7-2-1-5-3-6-8(15)4-9(16)11(18)13(6)19-12(5)10(7)17/h1-4,14-15,17-18H |
| InChIKey | VZGVARIFEMHVLB-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 111.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.20 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|