About acetaldehyde;1-benzofuran-7-ol
acetaldehyde;1-benzofuran-7-ol (PubChem CID 87738813) has the molecular formula C10H10O3
and a molecular weight of 178.19 g/mol. Its IUPAC name is acetaldehyde;1-benzofuran-7-ol.
Molecular Properties
| Compound Name | acetaldehyde;1-benzofuran-7-ol |
| PubChem CID | 87738813 |
| Molecular Formula | C10H10O3 |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.06 |
| IUPAC Name | acetaldehyde;1-benzofuran-7-ol |
| SMILES | CC=O.Oc1cccc2ccoc12 |
| InChI | InChI=1S/C8H6O2.C2H4O/c9-7-3-1-2-6-4-5-10-8(6)7;1-2-3/h1-5,9H;2H,1H3 |
| InChIKey | UMCSTXRTGYERPZ-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze acetaldehyde;1-benzofuran-7-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetaldehyde;1-benzofuran-7-ol?
The IUPAC name of acetaldehyde;1-benzofuran-7-ol (CID 87738813) is acetaldehyde;1-benzofuran-7-ol.
What is the SMILES notation for acetaldehyde;1-benzofuran-7-ol?
The canonical SMILES for acetaldehyde;1-benzofuran-7-ol is CC=O.Oc1cccc2ccoc12.
What is the InChIKey of acetaldehyde;1-benzofuran-7-ol?
The InChIKey is UMCSTXRTGYERPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6O2.C2H4O/c9-7-3-1-2-6-4-5-10-8(6)7;1-2-3/h1-5,9H;2H,1H3.
What are the key properties of acetaldehyde;1-benzofuran-7-ol?
acetaldehyde;1-benzofuran-7-ol has a molecular weight of 178.19 g/mol, XLogP of 2.34, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acetaldehyde;1-benzofuran-7-ol is sourced from PubChem (CID 87738813), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).