C30H22O14S — CID 167616535
2-acetylbenzo[f][1]benzofuran-4,9-dione;2,2-diacetyl-3-hydroxy-3H-benzo[f][1]benzofuran-4,9-dione;sulfuric acid (PubChem CID 167616535) has the molecular formula C30H22O14S and a molecular weight of 638.56 g/mol. Its IUPAC name is 2-acetylbenzo[f][1]benzofuran-4,9-dione;2,2-diacetyl-3-hydroxy-3H-benzo[f][1]benzofuran-4,9-dione;sulfuric acid.
| Compound Name | 2-acetylbenzo[f][1]benzofuran-4,9-dione;2,2-diacetyl-3-hydroxy-3H-benzo[f][1]benzofuran-4,9-dione;sulfuric acid |
|---|---|
| PubChem CID | 167616535 |
| Molecular Formula | C30H22O14S |
| Molecular Weight | 638.56 g/mol |
| Exact Mass | 638.07 |
| IUPAC Name | 2-acetylbenzo[f][1]benzofuran-4,9-dione;2,2-diacetyl-3-hydroxy-3H-benzo[f][1]benzofuran-4,9-dione;sulfuric acid |
| SMILES | CC(=O)C1(C(C)=O)OC2=C(C(=O)c3ccccc3C2=O)C1O.CC(=O)c1cc2c(o1)C(=O)c1ccccc1C2=O.O=S(=O)(O)O |
| InChI | InChI=1S/C16H12O6.C14H8O4.H2O4S/c1-7(17)16(8(2)18)15(21)11-12(19)9-5-3-4-6-10(9)13(20)14(11)22-16;1-7(15)11-6-10-12(16)8-4-2-3-5-9(8)13(17)14(10)18-11;1-5(2,3)4/h3-6,15,21H,1-2H3;2-6H,1H3;(H2,1,2,3,4) |
| InChIKey | PBBORNQYVSZQKV-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 236.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.56 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|