C32H26O11 — CID 163106337
5-hydroxy-6-(5-hydroxy-2,8,10-trimethoxy-4-oxobenzo[h]chromen-9-yl)-8,10-dimethoxy-2-methylbenzo[h]chromen-4-one (PubChem CID 163106337) has the molecular formula C32H26O11 and a molecular weight of 586.55 g/mol. Its IUPAC name is 5-hydroxy-6-(5-hydroxy-2,8,10-trimethoxy-4-oxobenzo[h]chromen-9-yl)-8,10-dimethoxy-2-methylbenzo[h]chromen-4-one.
| Compound Name | 5-hydroxy-6-(5-hydroxy-2,8,10-trimethoxy-4-oxobenzo[h]chromen-9-yl)-8,10-dimethoxy-2-methylbenzo[h]chromen-4-one |
|---|---|
| PubChem CID | 163106337 |
| Molecular Formula | C32H26O11 |
| Molecular Weight | 586.55 g/mol |
| Exact Mass | 586.15 |
| IUPAC Name | 5-hydroxy-6-(5-hydroxy-2,8,10-trimethoxy-4-oxobenzo[h]chromen-9-yl)-8,10-dimethoxy-2-methylbenzo[h]chromen-4-one |
| SMILES | COc1cc(OC)c2c(c1)c(-c1c(OC)cc3cc(O)c4c(=O)cc(OC)oc4c3c1OC)c(O)c1c(=O)cc(C)oc12 |
| InChI | InChI=1S/C32H26O11/c1-13-7-17(33)27-29(36)25(16-10-15(37-2)11-21(39-4)24(16)32(27)42-13)28-20(38-3)9-14-8-18(34)26-19(35)12-22(40-5)43-31(26)23(14)30(28)41-6/h7-12,34,36H,1-6H3 |
| InChIKey | VRAXHZQGYCOOCL-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 147.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.55 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|