C14H12N2O4S — CID 10040708
1-(4-hydroxy-7-methyl-5-oxofuro[3,2-g]chromen-9-yl)-3-methylthiourea (PubChem CID 10040708) has the molecular formula C14H12N2O4S and a molecular weight of 304.33 g/mol. Its IUPAC name is 1-(4-hydroxy-7-methyl-5-oxofuro[3,2-g]chromen-9-yl)-3-methylthiourea.
| Compound Name | 1-(4-hydroxy-7-methyl-5-oxofuro[3,2-g]chromen-9-yl)-3-methylthiourea |
|---|---|
| PubChem CID | 10040708 |
| Molecular Formula | C14H12N2O4S |
| Molecular Weight | 304.33 g/mol |
| Exact Mass | 304.05 |
| IUPAC Name | 1-(4-hydroxy-7-methyl-5-oxofuro[3,2-g]chromen-9-yl)-3-methylthiourea |
| SMILES | CNC(=S)Nc1c2occc2c(O)c2c(=O)cc(C)oc12 |
| InChI | InChI=1S/C14H12N2O4S/c1-6-5-8(17)9-11(18)7-3-4-19-12(7)10(13(9)20-6)16-14(21)15-2/h3-5,18H,1-2H3,(H2,15,16,21) |
| InChIKey | HZFPHQBWEHEIAH-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 87.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.33 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|