C19H15BrFN3O4S — CID 135894441
1-[(E)-(8-bromo-7-hydroxy-5-methoxy-2-methyl-4-oxochromen-6-yl)methylideneamino]-3-(4-fluorophenyl)thiourea (PubChem CID 135894441) has the molecular formula C19H15BrFN3O4S and a molecular weight of 480.32 g/mol. Its IUPAC name is 1-[(E)-(8-bromo-7-hydroxy-5-methoxy-2-methyl-4-oxochromen-6-yl)methylideneamino]-3-(4-fluorophenyl)thiourea.
| Compound Name | 1-[(E)-(8-bromo-7-hydroxy-5-methoxy-2-methyl-4-oxochromen-6-yl)methylideneamino]-3-(4-fluorophenyl)thiourea |
|---|---|
| PubChem CID | 135894441 |
| Molecular Formula | C19H15BrFN3O4S |
| Molecular Weight | 480.32 g/mol |
| Exact Mass | 479.00 |
| IUPAC Name | 1-[(E)-(8-bromo-7-hydroxy-5-methoxy-2-methyl-4-oxochromen-6-yl)methylideneamino]-3-(4-fluorophenyl)thiourea |
| SMILES | COc1c(/C=N/NC(=S)Nc2ccc(F)cc2)c(O)c(Br)c2oc(C)cc(=O)c12 |
| InChI | InChI=1S/C19H15BrFN3O4S/c1-9-7-13(25)14-17(27-2)12(16(26)15(20)18(14)28-9)8-22-24-19(29)23-11-5-3-10(21)4-6-11/h3-8,26H,1-2H3,(H2,23,24,29)/b22-8+ |
| InChIKey | FGEANEDCXDPJAY-GZIVZEMBSA-N |
| XLogP | 4.04 |
| TPSA | 96.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.32 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|