C15H16BrN3O3S2 — CID 135894444
1-[(E)-(8-bromo-7-hydroxy-5-methoxy-2-methyl-4-sulfanylidenechromen-6-yl)methylideneamino]-3-ethylthiourea (PubChem CID 135894444) has the molecular formula C15H16BrN3O3S2 and a molecular weight of 430.35 g/mol. Its IUPAC name is 1-[(E)-(8-bromo-7-hydroxy-5-methoxy-2-methyl-4-sulfanylidenechromen-6-yl)methylideneamino]-3-ethylthiourea.
| Compound Name | 1-[(E)-(8-bromo-7-hydroxy-5-methoxy-2-methyl-4-sulfanylidenechromen-6-yl)methylideneamino]-3-ethylthiourea |
|---|---|
| PubChem CID | 135894444 |
| Molecular Formula | C15H16BrN3O3S2 |
| Molecular Weight | 430.35 g/mol |
| Exact Mass | 428.98 |
| IUPAC Name | 1-[(E)-(8-bromo-7-hydroxy-5-methoxy-2-methyl-4-sulfanylidenechromen-6-yl)methylideneamino]-3-ethylthiourea |
| SMILES | CCNC(=S)N/N=C/c1c(O)c(Br)c2oc(C)cc(=S)c2c1OC |
| InChI | InChI=1S/C15H16BrN3O3S2/c1-4-17-15(24)19-18-6-8-12(20)11(16)14-10(13(8)21-3)9(23)5-7(2)22-14/h5-6,20H,4H2,1-3H3,(H2,17,19,24)/b18-6+ |
| InChIKey | ZLKZRAGYBYQDDV-NGYBGAFCSA-N |
| XLogP | 3.77 |
| TPSA | 79.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.35 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|