C19H17N3O4S — CID 135912218
1-[(E)-(7-hydroxy-5-methoxy-4-oxo-2-phenylchromen-6-yl)methylideneamino]-3-methylthiourea (PubChem CID 135912218) has the molecular formula C19H17N3O4S and a molecular weight of 383.43 g/mol. Its IUPAC name is 1-[(E)-(7-hydroxy-5-methoxy-4-oxo-2-phenylchromen-6-yl)methylideneamino]-3-methylthiourea.
| Compound Name | 1-[(E)-(7-hydroxy-5-methoxy-4-oxo-2-phenylchromen-6-yl)methylideneamino]-3-methylthiourea |
|---|---|
| PubChem CID | 135912218 |
| Molecular Formula | C19H17N3O4S |
| Molecular Weight | 383.43 g/mol |
| Exact Mass | 383.09 |
| IUPAC Name | 1-[(E)-(7-hydroxy-5-methoxy-4-oxo-2-phenylchromen-6-yl)methylideneamino]-3-methylthiourea |
| SMILES | CNC(=S)N/N=C/c1c(O)cc2oc(-c3ccccc3)cc(=O)c2c1OC |
| InChI | InChI=1S/C19H17N3O4S/c1-20-19(27)22-21-10-12-13(23)8-16-17(18(12)25-2)14(24)9-15(26-16)11-6-4-3-5-7-11/h3-10,23H,1-2H3,(H2,20,22,27)/b21-10+ |
| InChIKey | LTGCIIVCEUQQCX-UFFVCSGVSA-N |
| XLogP | 2.60 |
| TPSA | 96.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.43 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|