C20H18O4 — CID 167993314
5,7-dihydroxy-6-[(E)-3-methylbut-1-enyl]-2-phenylchromen-4-one (PubChem CID 167993314) has the molecular formula C20H18O4 and a molecular weight of 322.36 g/mol. Its IUPAC name is 5,7-dihydroxy-6-[(E)-3-methylbut-1-enyl]-2-phenylchromen-4-one.
| Compound Name | 5,7-dihydroxy-6-[(E)-3-methylbut-1-enyl]-2-phenylchromen-4-one |
|---|---|
| PubChem CID | 167993314 |
| Molecular Formula | C20H18O4 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | 5,7-dihydroxy-6-[(E)-3-methylbut-1-enyl]-2-phenylchromen-4-one |
| SMILES | CC(C)/C=C/c1c(O)cc2oc(-c3ccccc3)cc(=O)c2c1O |
| InChI | InChI=1S/C20H18O4/c1-12(2)8-9-14-15(21)10-18-19(20(14)23)16(22)11-17(24-18)13-6-4-3-5-7-13/h3-12,21,23H,1-2H3/b9-8+ |
| InChIKey | QRMFRNMTWYJJAO-CMDGGOBGSA-N |
| XLogP | 4.54 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |