C20H14N4O4 — CID 175172104
4-(4-ethoxyphenyl)-3-(2H-tetrazol-5-yl)furo[2,3-h]chromen-2-one (PubChem CID 175172104) has the molecular formula C20H14N4O4 and a molecular weight of 374.36 g/mol. Its IUPAC name is 4-(4-ethoxyphenyl)-3-(2H-tetrazol-5-yl)furo[2,3-h]chromen-2-one.
| Compound Name | 4-(4-ethoxyphenyl)-3-(2H-tetrazol-5-yl)furo[2,3-h]chromen-2-one |
|---|---|
| PubChem CID | 175172104 |
| Molecular Formula | C20H14N4O4 |
| Molecular Weight | 374.36 g/mol |
| Exact Mass | 374.10 |
| IUPAC Name | 4-(4-ethoxyphenyl)-3-(2H-tetrazol-5-yl)furo[2,3-h]chromen-2-one |
| SMILES | CCOc1ccc(-c2c(-c3nn[nH]n3)c(=O)oc3c2ccc2occc23)cc1 |
| InChI | InChI=1S/C20H14N4O4/c1-2-26-12-5-3-11(4-6-12)16-14-7-8-15-13(9-10-27-15)18(14)28-20(25)17(16)19-21-23-24-22-19/h3-10H,2H2,1H3,(H,21,22,23,24) |
| InChIKey | NFWZFGUTQQYXSX-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 107.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.36 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|