C16H12N4O3 — CID 53424554
2-ethoxy-6-(2H-tetrazol-5-yl)xanthen-1-one (PubChem CID 53424554) has the molecular formula C16H12N4O3 and a molecular weight of 308.30 g/mol. Its IUPAC name is 2-ethoxy-6-(2H-tetrazol-5-yl)xanthen-1-one.
| Compound Name | 2-ethoxy-6-(2H-tetrazol-5-yl)xanthen-1-one |
|---|---|
| PubChem CID | 53424554 |
| Molecular Formula | C16H12N4O3 |
| Molecular Weight | 308.30 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | 2-ethoxy-6-(2H-tetrazol-5-yl)xanthen-1-one |
| SMILES | CCOc1ccc2oc3cc(-c4nn[nH]n4)ccc3cc-2c1=O |
| InChI | InChI=1S/C16H12N4O3/c1-2-22-13-6-5-12-11(15(13)21)7-9-3-4-10(8-14(9)23-12)16-17-19-20-18-16/h3-8H,2H2,1H3,(H,17,18,19,20) |
| InChIKey | MCJNUJDPQVQFFN-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 93.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.30 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|