C13H20N4O4 — CID 143271209
2-ethoxy-6-methyl-4-(2H-tetrazol-5-yl)phenol;formaldehyde;methoxymethane (PubChem CID 143271209) has the molecular formula C13H20N4O4 and a molecular weight of 296.33 g/mol. Its IUPAC name is 2-ethoxy-6-methyl-4-(2H-tetrazol-5-yl)phenol;formaldehyde;methoxymethane.
| Compound Name | 2-ethoxy-6-methyl-4-(2H-tetrazol-5-yl)phenol;formaldehyde;methoxymethane |
|---|---|
| PubChem CID | 143271209 |
| Molecular Formula | C13H20N4O4 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | 2-ethoxy-6-methyl-4-(2H-tetrazol-5-yl)phenol;formaldehyde;methoxymethane |
| SMILES | C=O.CCOc1cc(-c2nn[nH]n2)cc(C)c1O.COC |
| InChI | InChI=1S/C10H12N4O2.C2H6O.CH2O/c1-3-16-8-5-7(4-6(2)9(8)15)10-11-13-14-12-10;1-3-2;1-2/h4-5,15H,3H2,1-2H3,(H,11,12,13,14);1-2H3;1H2 |
| InChIKey | AIZGGNYZXOLCDQ-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 110.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |