C13H12N6O3 — CID 13138697
5-(3,4-dimethoxyphenyl)-2-(2H-tetrazol-5-yl)-1H-pyrimidin-6-one (PubChem CID 13138697) has the molecular formula C13H12N6O3 and a molecular weight of 300.28 g/mol. Its IUPAC name is 5-(3,4-dimethoxyphenyl)-2-(2H-tetrazol-5-yl)-1H-pyrimidin-6-one.
| Compound Name | 5-(3,4-dimethoxyphenyl)-2-(2H-tetrazol-5-yl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 13138697 |
| Molecular Formula | C13H12N6O3 |
| Molecular Weight | 300.28 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | 5-(3,4-dimethoxyphenyl)-2-(2H-tetrazol-5-yl)-1H-pyrimidin-6-one |
| SMILES | COc1ccc(-c2cnc(-c3nn[nH]n3)[nH]c2=O)cc1OC |
| InChI | InChI=1S/C13H12N6O3/c1-21-9-4-3-7(5-10(9)22-2)8-6-14-11(15-13(8)20)12-16-18-19-17-12/h3-6H,1-2H3,(H,14,15,20)(H,16,17,18,19) |
| InChIKey | ANTVLEJFTFEASR-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 118.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.28 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |