C19H15F4N5O2 — CID 118452474
4-ethoxy-N-[[5-fluoro-2-(2H-tetrazol-5-yl)-1-benzofuran-6-yl]methyl]-3-(trifluoromethyl)aniline (PubChem CID 118452474) has the molecular formula C19H15F4N5O2 and a molecular weight of 421.35 g/mol. Its IUPAC name is 4-ethoxy-N-[[5-fluoro-2-(2H-tetrazol-5-yl)-1-benzofuran-6-yl]methyl]-3-(trifluoromethyl)aniline.
| Compound Name | 4-ethoxy-N-[[5-fluoro-2-(2H-tetrazol-5-yl)-1-benzofuran-6-yl]methyl]-3-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 118452474 |
| Molecular Formula | C19H15F4N5O2 |
| Molecular Weight | 421.35 g/mol |
| Exact Mass | 421.12 |
| IUPAC Name | 4-ethoxy-N-[[5-fluoro-2-(2H-tetrazol-5-yl)-1-benzofuran-6-yl]methyl]-3-(trifluoromethyl)aniline |
| SMILES | CCOc1ccc(NCc2cc3oc(-c4nn[nH]n4)cc3cc2F)cc1C(F)(F)F |
| InChI | InChI=1S/C19H15F4N5O2/c1-2-29-15-4-3-12(8-13(15)19(21,22)23)24-9-11-7-16-10(5-14(11)20)6-17(30-16)18-25-27-28-26-18/h3-8,24H,2,9H2,1H3,(H,25,26,27,28) |
| InChIKey | JFZOIGPOXHMTTJ-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 88.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.35 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|