C18H11BrF2N6O2 — CID 118452681
5-[[5-bromo-2-(2H-tetrazol-5-yl)-1-benzofuran-6-yl]methylamino]-2-(difluoromethoxy)benzonitrile (PubChem CID 118452681) has the molecular formula C18H11BrF2N6O2 and a molecular weight of 461.23 g/mol. Its IUPAC name is 5-[[5-bromo-2-(2H-tetrazol-5-yl)-1-benzofuran-6-yl]methylamino]-2-(difluoromethoxy)benzonitrile.
| Compound Name | 5-[[5-bromo-2-(2H-tetrazol-5-yl)-1-benzofuran-6-yl]methylamino]-2-(difluoromethoxy)benzonitrile |
|---|---|
| PubChem CID | 118452681 |
| Molecular Formula | C18H11BrF2N6O2 |
| Molecular Weight | 461.23 g/mol |
| Exact Mass | 460.01 |
| IUPAC Name | 5-[[5-bromo-2-(2H-tetrazol-5-yl)-1-benzofuran-6-yl]methylamino]-2-(difluoromethoxy)benzonitrile |
| SMILES | N#Cc1cc(NCc2cc3oc(-c4nn[nH]n4)cc3cc2Br)ccc1OC(F)F |
| InChI | InChI=1S/C18H11BrF2N6O2/c19-13-4-9-5-16(17-24-26-27-25-17)28-15(9)6-11(13)8-23-12-1-2-14(29-18(20)21)10(3-12)7-22/h1-6,18,23H,8H2,(H,24,25,26,27) |
| InChIKey | FWKJSIHGYVVKLC-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.23 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|