C16H14BrClN2O2 — CID 112831630
4-[(2-bromo-4,5-dimethoxyphenyl)methylamino]-2-chlorobenzonitrile (PubChem CID 112831630) has the molecular formula C16H14BrClN2O2 and a molecular weight of 381.66 g/mol. Its IUPAC name is 4-[(2-bromo-4,5-dimethoxyphenyl)methylamino]-2-chlorobenzonitrile.
| Compound Name | 4-[(2-bromo-4,5-dimethoxyphenyl)methylamino]-2-chlorobenzonitrile |
|---|---|
| PubChem CID | 112831630 |
| Molecular Formula | C16H14BrClN2O2 |
| Molecular Weight | 381.66 g/mol |
| Exact Mass | 379.99 |
| IUPAC Name | 4-[(2-bromo-4,5-dimethoxyphenyl)methylamino]-2-chlorobenzonitrile |
| SMILES | COc1cc(Br)c(CNc2ccc(C#N)c(Cl)c2)cc1OC |
| InChI | InChI=1S/C16H14BrClN2O2/c1-21-15-5-11(13(17)7-16(15)22-2)9-20-12-4-3-10(8-19)14(18)6-12/h3-7,20H,9H2,1-2H3 |
| InChIKey | LLMPONYMDIRXJG-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 54.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.66 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |