About 3-[(2-bromo-4,5-dimethoxyphenyl)methylamino]pyridine-4-carbonitrile
3-[(2-bromo-4,5-dimethoxyphenyl)methylamino]pyridine-4-carbonitrile (PubChem CID 84593512) has the molecular formula C15H14BrN3O2
and a molecular weight of 348.20 g/mol. Its IUPAC name is 3-[(2-bromo-4,5-dimethoxyphenyl)methylamino]pyridine-4-carbonitrile.
Molecular Properties
| Compound Name | 3-[(2-bromo-4,5-dimethoxyphenyl)methylamino]pyridine-4-carbonitrile |
| PubChem CID | 84593512 |
| Molecular Formula | C15H14BrN3O2 |
| Molecular Weight | 348.20 g/mol |
| Exact Mass | 347.03 |
| IUPAC Name | 3-[(2-bromo-4,5-dimethoxyphenyl)methylamino]pyridine-4-carbonitrile |
| SMILES | COc1cc(Br)c(CNc2cnccc2C#N)cc1OC |
| InChI | InChI=1S/C15H14BrN3O2/c1-20-14-5-11(12(16)6-15(14)21-2)8-19-13-9-18-4-3-10(13)7-17/h3-6,9,19H,8H2,1-2H3 |
| InChIKey | KDAOGROFIRVDHU-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 67.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.20 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[(2-bromo-4,5-dimethoxyphenyl)methylamino]pyridine-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2-bromo-4,5-dimethoxyphenyl)methylamino]pyridine-4-carbonitrile?
The IUPAC name of 3-[(2-bromo-4,5-dimethoxyphenyl)methylamino]pyridine-4-carbonitrile (CID 84593512) is 3-[(2-bromo-4,5-dimethoxyphenyl)methylamino]pyridine-4-carbonitrile.
What is the SMILES notation for 3-[(2-bromo-4,5-dimethoxyphenyl)methylamino]pyridine-4-carbonitrile?
The canonical SMILES for 3-[(2-bromo-4,5-dimethoxyphenyl)methylamino]pyridine-4-carbonitrile is COc1cc(Br)c(CNc2cnccc2C#N)cc1OC.
What is the InChIKey of 3-[(2-bromo-4,5-dimethoxyphenyl)methylamino]pyridine-4-carbonitrile?
The InChIKey is KDAOGROFIRVDHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14BrN3O2/c1-20-14-5-11(12(16)6-15(14)21-2)8-19-13-9-18-4-3-10(13)7-17/h3-6,9,19H,8H2,1-2H3.
What are the key properties of 3-[(2-bromo-4,5-dimethoxyphenyl)methylamino]pyridine-4-carbonitrile?
3-[(2-bromo-4,5-dimethoxyphenyl)methylamino]pyridine-4-carbonitrile has a molecular weight of 348.20 g/mol, XLogP of 3.35, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2-bromo-4,5-dimethoxyphenyl)methylamino]pyridine-4-carbonitrile is sourced from PubChem (CID 84593512), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).