C14H17N5O4 — CID 146146539
ethyl 2-[methyl-[2-[4-(2H-tetrazol-5-yl)phenoxy]acetyl]amino]acetate (PubChem CID 146146539) has the molecular formula C14H17N5O4 and a molecular weight of 319.32 g/mol. Its IUPAC name is ethyl 2-[methyl-[2-[4-(2H-tetrazol-5-yl)phenoxy]acetyl]amino]acetate.
| Compound Name | ethyl 2-[methyl-[2-[4-(2H-tetrazol-5-yl)phenoxy]acetyl]amino]acetate |
|---|---|
| PubChem CID | 146146539 |
| Molecular Formula | C14H17N5O4 |
| Molecular Weight | 319.32 g/mol |
| Exact Mass | 319.13 |
| IUPAC Name | ethyl 2-[methyl-[2-[4-(2H-tetrazol-5-yl)phenoxy]acetyl]amino]acetate |
| SMILES | CCOC(=O)CN(C)C(=O)COc1ccc(-c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C14H17N5O4/c1-3-22-13(21)8-19(2)12(20)9-23-11-6-4-10(5-7-11)14-15-17-18-16-14/h4-7H,3,8-9H2,1-2H3,(H,15,16,17,18) |
| InChIKey | XCTNUHJCMGAGDY-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 110.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.32 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |