C26H31N5O4 — CID 11951811
ethyl 2-[4-propyl-5-[4-[4-(2H-tetrazol-5-yl)phenoxy]butoxy]indol-1-yl]acetate (PubChem CID 11951811) has the molecular formula C26H31N5O4 and a molecular weight of 477.57 g/mol. Its IUPAC name is ethyl 2-[4-propyl-5-[4-[4-(2H-tetrazol-5-yl)phenoxy]butoxy]indol-1-yl]acetate.
| Compound Name | ethyl 2-[4-propyl-5-[4-[4-(2H-tetrazol-5-yl)phenoxy]butoxy]indol-1-yl]acetate |
|---|---|
| PubChem CID | 11951811 |
| Molecular Formula | C26H31N5O4 |
| Molecular Weight | 477.57 g/mol |
| Exact Mass | 477.24 |
| IUPAC Name | ethyl 2-[4-propyl-5-[4-[4-(2H-tetrazol-5-yl)phenoxy]butoxy]indol-1-yl]acetate |
| SMILES | CCCc1c(OCCCCOc2ccc(-c3nn[nH]n3)cc2)ccc2c1ccn2CC(=O)OCC |
| InChI | InChI=1S/C26H31N5O4/c1-3-7-22-21-14-15-31(18-25(32)33-4-2)23(21)12-13-24(22)35-17-6-5-16-34-20-10-8-19(9-11-20)26-27-29-30-28-26/h8-15H,3-7,16-18H2,1-2H3,(H,27,28,29,30) |
| InChIKey | OJJMYCCSFFOIRJ-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 104.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.57 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|