C27H29F3N2O5 — CID 11519200
methyl 2-[5-[5-[[7-propyl-3-(trifluoromethyl)-1,2-benzoxazol-6-yl]oxy]pentoxy]indol-1-yl]acetate (PubChem CID 11519200) has the molecular formula C27H29F3N2O5 and a molecular weight of 518.53 g/mol. Its IUPAC name is methyl 2-[5-[5-[[7-propyl-3-(trifluoromethyl)-1,2-benzoxazol-6-yl]oxy]pentoxy]indol-1-yl]acetate.
| Compound Name | methyl 2-[5-[5-[[7-propyl-3-(trifluoromethyl)-1,2-benzoxazol-6-yl]oxy]pentoxy]indol-1-yl]acetate |
|---|---|
| PubChem CID | 11519200 |
| Molecular Formula | C27H29F3N2O5 |
| Molecular Weight | 518.53 g/mol |
| Exact Mass | 518.20 |
| IUPAC Name | methyl 2-[5-[5-[[7-propyl-3-(trifluoromethyl)-1,2-benzoxazol-6-yl]oxy]pentoxy]indol-1-yl]acetate |
| SMILES | CCCc1c(OCCCCCOc2ccc3c(ccn3CC(=O)OC)c2)ccc2c(C(F)(F)F)noc12 |
| InChI | InChI=1S/C27H29F3N2O5/c1-3-7-20-23(11-9-21-25(20)37-31-26(21)27(28,29)30)36-15-6-4-5-14-35-19-8-10-22-18(16-19)12-13-32(22)17-24(33)34-2/h8-13,16H,3-7,14-15,17H2,1-2H3 |
| InChIKey | ZSUIZJYJBPPHGJ-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 75.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.53 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|