C31H43F3N2O5 — CID 142247338
6-butoxy-7-propyl-3-(trifluoromethyl)-1,2-benzoxazole;tert-butyl 2-[2-(formamidomethyl)phenyl]acetate;ethane (PubChem CID 142247338) has the molecular formula C31H43F3N2O5 and a molecular weight of 580.69 g/mol. Its IUPAC name is 6-butoxy-7-propyl-3-(trifluoromethyl)-1,2-benzoxazole;tert-butyl 2-[2-(formamidomethyl)phenyl]acetate;ethane.
| Compound Name | 6-butoxy-7-propyl-3-(trifluoromethyl)-1,2-benzoxazole;tert-butyl 2-[2-(formamidomethyl)phenyl]acetate;ethane |
|---|---|
| PubChem CID | 142247338 |
| Molecular Formula | C31H43F3N2O5 |
| Molecular Weight | 580.69 g/mol |
| Exact Mass | 580.31 |
| IUPAC Name | 6-butoxy-7-propyl-3-(trifluoromethyl)-1,2-benzoxazole;tert-butyl 2-[2-(formamidomethyl)phenyl]acetate;ethane |
| SMILES | CC.CC(C)(C)OC(=O)Cc1ccccc1CNC=O.CCCCOc1ccc2c(C(F)(F)F)noc2c1CCC |
| InChI | InChI=1S/C15H18F3NO2.C14H19NO3.C2H6/c1-3-5-9-20-12-8-7-11-13(10(12)6-4-2)21-19-14(11)15(16,17)18;1-14(2,3)18-13(17)8-11-6-4-5-7-12(11)9-15-10-16;1-2/h7-8H,3-6,9H2,1-2H3;4-7,10H,8-9H2,1-3H3,(H,15,16);1-2H3 |
| InChIKey | LYALUMUINMTUEB-UHFFFAOYSA-N |
| XLogP | 7.82 |
| TPSA | 90.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.69 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|