C23H23F3N2O5 — CID 10288584
3-[methyl-[3-[[7-propyl-3-(trifluoromethyl)-1,2-benzoxazol-6-yl]oxy]propyl]carbamoyl]benzoic acid (PubChem CID 10288584) has the molecular formula C23H23F3N2O5 and a molecular weight of 464.44 g/mol. Its IUPAC name is 3-[methyl-[3-[[7-propyl-3-(trifluoromethyl)-1,2-benzoxazol-6-yl]oxy]propyl]carbamoyl]benzoic acid.
| Compound Name | 3-[methyl-[3-[[7-propyl-3-(trifluoromethyl)-1,2-benzoxazol-6-yl]oxy]propyl]carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 10288584 |
| Molecular Formula | C23H23F3N2O5 |
| Molecular Weight | 464.44 g/mol |
| Exact Mass | 464.16 |
| IUPAC Name | 3-[methyl-[3-[[7-propyl-3-(trifluoromethyl)-1,2-benzoxazol-6-yl]oxy]propyl]carbamoyl]benzoic acid |
| SMILES | CCCc1c(OCCCN(C)C(=O)c2cccc(C(=O)O)c2)ccc2c(C(F)(F)F)noc12 |
| InChI | InChI=1S/C23H23F3N2O5/c1-3-6-16-18(10-9-17-19(16)33-27-20(17)23(24,25)26)32-12-5-11-28(2)21(29)14-7-4-8-15(13-14)22(30)31/h4,7-10,13H,3,5-6,11-12H2,1-2H3,(H,30,31) |
| InChIKey | PSSVMPULZFLBLS-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 92.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.44 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|